CAS 313368-81-9 is the registry number for Lumateperone Impurity 12. Offered by: Chemat Brand. Available pack sizes: on request.
(10R,15S)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (CAS 313368-81-9) is a chemical compound with the molecular formula C13H17N3 and a molecular weight of 215.29 g/mol. IUPAC name: (10R,15S)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene. InChIKey: LEDSAIXFIJNHLZ-JQWIXIFHSA-N.
| Molecular formula | C13H17N3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | (10R,15S)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| InChIKey | LEDSAIXFIJNHLZ-JQWIXIFHSA-N |
| SMILES | C1CNC[C@@H]2[C@H]1N3CCNC4=CC=CC2=C43 |
Computed by PubChem (NCBI)