Products 313534-73-5
CAS 313534-73-5 is the registry number for 3-(Adamantan-1-yl)-3-aminopropanoic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
3-(1-adamantyl)-3-aminopropanoic acid (CAS 313534-73-5) is a chemical compound with the molecular formula C13H21NO2 and a molecular weight of 223.31 g/mol. IUPAC name: 3-(1-adamantyl)-3-aminopropanoic acid. InChIKey: AMRNUEMIMYEDBK-UHFFFAOYSA-N.
| Molecular formula | C13H21NO2 |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | 3-(1-adamantyl)-3-aminopropanoic acid |
| InChIKey | AMRNUEMIMYEDBK-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(CC(=O)O)N |
Computed by PubChem (NCBI)