CAS 313544-76-2 is the registry number for Lumateperone Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl (10R,15S)-4-methyl-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate (CAS 313544-76-2) is a chemical compound with the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. IUPAC name: ethyl (10R,15S)-4-methyl-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate. InChIKey: FAGHUWIRBRMPCV-STQMWFEESA-N.
| Molecular formula | C17H21N3O3 |
|---|---|
| Molecular weight | 315.37 g/mol |
| IUPAC name | ethyl (10R,15S)-4-methyl-3-oxo-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene-12-carboxylate |
| InChIKey | FAGHUWIRBRMPCV-STQMWFEESA-N |
| SMILES | CCOC(=O)N1CC[C@H]2[C@@H](C1)C3=C4N2CC(=O)N(C4=CC=C3)C |
Computed by PubChem (NCBI)