CAS 908259-42-7 is the registry number for N-Boc-N’-(4-cyanobenzyl)-2-L-azetidinecarboxamide. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
Tert-butyl (2S)-2-[(4-cyanophenyl)methylcarbamoyl]azetidine-1-carboxylate (CAS 908259-42-7) is a chemical compound with the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. IUPAC name: tert-butyl (2S)-2-[(4-cyanophenyl)methylcarbamoyl]azetidine-1-carboxylate. InChIKey: FVRHYUFGRVBYDA-AWEZNQCLSA-N.
| Molecular formula | C17H21N3O3 |
|---|---|
| Molecular weight | 315.37 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(4-cyanophenyl)methylcarbamoyl]azetidine-1-carboxylate |
| InChIKey | FVRHYUFGRVBYDA-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1C(=O)NCC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)