Products 31363-74-3
CAS 31363-74-3 is the registry number for 5,7-Dihydroxytryptamine hydrobromide, 94.00%. Offered by: Chemat. Available pack sizes: 10mg, 250mg, 25mg.
3-(2-aminoethyl)-1H-indole-5,7-diol (CAS 31363-74-3) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 3-(2-aminoethyl)-1H-indole-5,7-diol. InChIKey: LXWHQTNFZDTKBH-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 3-(2-aminoethyl)-1H-indole-5,7-diol |
| InChIKey | LXWHQTNFZDTKBH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CN2)CCN)O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(2-Aminoethyl)-1H-indole-5,7-diol, 1H-Indole-5,7-diol, 3-(2-aminoethyl)-, 5,7 Dihydroxytryptamine, 5,7 Dihydroxytryptamine Creatine Sulfate, Creatine Sulfate, 5,7-Dihydroxytryptamine, Sulfate, 5,7-Dihydroxytryptamine Creatine, LXWHQTNFZDTKBH-UHFFFAOYSA-N, 3-(2-Aminoethyl )-1h-indole-5,7-diol