Products 140-50-1
CAS 140-50-1 appears in our catalog under these names: N,N'-Diacetyl-1,4-phenylenediamine, 98%, N，N'–Diacetyl–1，4–phenylenediamine, N,N'-p-Phenylenebisacetamide, 98% , N,N'-Diacetyl-1,4-phenylenediamine, >98.0%(GC)(N), N,N'-1,4-Phenylenebisacetamide, 98%, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 25g, 1g, 5g, 100g.
N-(4-acetamidophenyl)acetamide (CAS 140-50-1) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: N-(4-acetamidophenyl)acetamide. InChIKey: KVEDKKLZCJBVNP-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | N-(4-acetamidophenyl)acetamide |
| InChIKey | KVEDKKLZCJBVNP-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)NC(=O)C |
Computed by PubChem (NCBI)