CAS 31386-36-4 appears in our catalog under these names: (R)-2-Acetamido-3-(ethylthio)propanoic acid, 98%, N-Acetyl-S-ethyl-L-cysteine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 25mg.
(2R)-2-acetamido-3-ethylsulfanylpropanoic acid (CAS 31386-36-4) is a chemical compound with the molecular formula C7H13NO3S and a molecular weight of 191.25 g/mol. IUPAC name: (2R)-2-acetamido-3-ethylsulfanylpropanoic acid. InChIKey: BSVHABSINROVJJ-LURJTMIESA-N.
| Molecular formula | C7H13NO3S |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | (2R)-2-acetamido-3-ethylsulfanylpropanoic acid |
| InChIKey | BSVHABSINROVJJ-LURJTMIESA-N |
| SMILES | CCSC[C@@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)