CAS 65-82-7 appears in our catalog under these names: N-Acetyl-L-methionine, 97%, N-Acetyl-L-methionine, >95% (HPLC), Methionine EP Impurity C (as (S)-Enantiomer), Ac–Met–OH, N-Acetyl-L-methionine/ 98%. Offered by: Combi-blocks, TRC, Mikromol, GLPBio, TargetMol. Available pack sizes: 1kg, 100g, 25g, 500g, 5g, 2,5g, 250mg, 500mg.
(2S)-2-acetamido-4-methylsulfanylbutanoic acid (CAS 65-82-7) is a chemical compound with the molecular formula C7H13NO3S and a molecular weight of 191.25 g/mol. IUPAC name: (2S)-2-acetamido-4-methylsulfanylbutanoic acid. InChIKey: XUYPXLNMDZIRQH-LURJTMIESA-N.
| Molecular formula | C7H13NO3S |
|---|---|
| Molecular weight | 191.25 g/mol |
| IUPAC name | (2S)-2-acetamido-4-methylsulfanylbutanoic acid |
| InChIKey | XUYPXLNMDZIRQH-LURJTMIESA-N |
| SMILES | CC(=O)N[C@@H](CCSC)C(=O)O |
Computed by PubChem (NCBI)