CAS 313959-54-5 is the registry number for 2-(((4-Tricyclo(3.3.1.13,7)dec-1-ylphenyl)amino)methyl)-1H-isoindole-1,3(2H)-dione. Offered by: TRC. Available pack sizes: 25mg.
2-[[4-(1-adamantyl)anilino]methyl]isoindole-1,3-dione (CAS 313959-54-5) is a chemical compound with the molecular formula C25H26N2O2 and a molecular weight of 386.5 g/mol. IUPAC name: 2-[[4-(1-adamantyl)anilino]methyl]isoindole-1,3-dione. InChIKey: OLKIRXUQSYOXAK-UHFFFAOYSA-N.
| Molecular formula | C25H26N2O2 |
|---|---|
| Molecular weight | 386.5 g/mol |
| IUPAC name | 2-[[4-(1-adamantyl)anilino]methyl]isoindole-1,3-dione |
| InChIKey | OLKIRXUQSYOXAK-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=CC=C(C=C4)NCN5C(=O)C6=CC=CC=C6C5=O |
Computed by PubChem (NCBI)