Products 31435-75-3
CAS 31435-75-3 is the registry number for 6-(Dimethylamino)-3,4-dihydronaphthalen-1(2H)-one, 95+%. Offered by: Fluorochem. Available pack sizes: 25mg.
6-(dimethylamino)-3,4-dihydro-2H-naphthalen-1-one (CAS 31435-75-3) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 6-(dimethylamino)-3,4-dihydro-2H-naphthalen-1-one. InChIKey: KLJWFFXNAZUXFJ-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 6-(dimethylamino)-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | KLJWFFXNAZUXFJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=O)CCC2 |
Computed by PubChem (NCBI)