Products 31499-54-4
CAS 31499-54-4 appears in our catalog under these names: 4–Azidobenzyl alcohol, 4-Azidobenzyl alcohol, (4-Azidophenyl)methanol, (4-Azidophenyl)methanol, 95%, 4-Azidobenzyl alcohol, 99.90%. Offered by: GLPBio, Iris Biotech, Biosynth, Combi-blocks, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1g, 250mg, 500mg.
(4-azidophenyl)methanol (CAS 31499-54-4) is a chemical compound with the molecular formula C7H7N3O and a molecular weight of 149.15 g/mol. IUPAC name: (4-azidophenyl)methanol. InChIKey: GEKVUCLUCOBNIE-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O |
|---|---|
| Molecular weight | 149.15 g/mol |
| IUPAC name | (4-azidophenyl)methanol |
| InChIKey | GEKVUCLUCOBNIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)N=[N+]=[N-] |
Computed by PubChem (NCBI)