CAS 383155-01-9 is the registry number for 1-Fluoro-8-hydroxynaphthalene, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
8-fluoronaphthalen-1-ol (CAS 383155-01-9) is a chemical compound with the molecular formula C10H7FO and a molecular weight of 162.16 g/mol. IUPAC name: 8-fluoronaphthalen-1-ol. InChIKey: PGUGLDZOLIXVEG-UHFFFAOYSA-N.
| Molecular formula | C10H7FO |
|---|---|
| Molecular weight | 162.16 g/mol |
| IUPAC name | 8-fluoronaphthalen-1-ol |
| InChIKey | PGUGLDZOLIXVEG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=CC=C2)F |
Computed by PubChem (NCBI)