CAS 31601-86-2 appears in our catalog under these names: 6,8-Dimethyl-4-oxo-1,4-dihydroquinoline-, 3-carboxylic acid, 100 mg, 6,8-Dimethyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 6,8-Dimethyl-4-oxo-1,4-dihydroquinoline-, 3-carboxylic acid, 250 mg, 6,8-Dimethyl-4-oxo-1,4-dihydroquinoline-, 3-carboxylic acid, 500 mg, 6,8-Dimethyl-4-oxo-1,4-dihydroquinoline-, 3-carboxylic acid, 1 g. Offered by: Roth, Biosynth. Available pack sizes: 100mg, 0,25g, 0,1g, 0,5g, 1g, 250mg, 500mg.
6,8-dimethyl-4-oxo-1H-quinoline-3-carboxylic acid (CAS 31601-86-2) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 6,8-dimethyl-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: IZUOQXWRSVPGRM-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 6,8-dimethyl-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | IZUOQXWRSVPGRM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=O)C(=CN2)C(=O)O)C |
Computed by PubChem (NCBI)