CAS 316379-15-4 is the registry number for 6-Azido-6-deoxy-D-mannose. Offered by: Biosynth. Available pack sizes: 200mg, 100mg.
6-azido-2,3,4,5-tetrahydroxyhexanal (CAS 316379-15-4) is a chemical compound with the molecular formula C6H11N3O5 and a molecular weight of 205.17 g/mol. IUPAC name: 6-azido-2,3,4,5-tetrahydroxyhexanal. InChIKey: HEYJIJWKSGKYTQ-UHFFFAOYSA-N.
| Molecular formula | C6H11N3O5 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 6-azido-2,3,4,5-tetrahydroxyhexanal |
| InChIKey | HEYJIJWKSGKYTQ-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C=O)O)O)O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)