CAS 31656-49-2 appears in our catalog under these names: Naphthalene–2,6–dicarbonitrile, Naphthalene-2,6-dicarbonitrile 95%, 2,6-Naphthalenedicarbonitrile, 97%, 97%, NAPHTHALENE-2,6-DICARBONITRILE, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
Naphthalene-2,6-dicarbonitrile (CAS 31656-49-2) is a chemical compound with the molecular formula C12H6N2 and a molecular weight of 178.19 g/mol. IUPAC name: naphthalene-2,6-dicarbonitrile. InChIKey: ZBFVJRBOKDTSMO-UHFFFAOYSA-N.
| Molecular formula | C12H6N2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | naphthalene-2,6-dicarbonitrile |
| InChIKey | ZBFVJRBOKDTSMO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C#N)C=C1C#N |
Computed by PubChem (NCBI)