CAS 39718-11-1 appears in our catalog under these names: naphthalene-2,7-dicarbonitrile, 95%, 2,7–Dicyanonaphthalene, 2,7-Dicyanonaphthalene, >94.0%(GC), Naphthalene-2,7-dicarbonitrile, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 250mg, 200mg, 100mg.
Naphthalene-2,7-dicarbonitrile (CAS 39718-11-1) is a chemical compound with the molecular formula C12H6N2 and a molecular weight of 178.19 g/mol. IUPAC name: naphthalene-2,7-dicarbonitrile. InChIKey: NNHXOKPHDUDDAK-UHFFFAOYSA-N.
| Molecular formula | C12H6N2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | naphthalene-2,7-dicarbonitrile |
| InChIKey | NNHXOKPHDUDDAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=C2)C#N)C#N |
Computed by PubChem (NCBI)