Products 31753-19-2
CAS 31753-19-2 appears in our catalog under these names: Prostaglandin A2 methyl ester, Prostaglandin A2 methyl ester. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, Get quote.
Methyl (Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate (CAS 31753-19-2) is a chemical compound with the molecular formula C21H32O4 and a molecular weight of 348.5 g/mol. IUPAC name: methyl (Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate. InChIKey: HVBMOWIJGLUCFB-PMPHTVEESA-N.
| Molecular formula | C21H32O4 |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | methyl (Z)-7-[(1R,2S)-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopent-3-en-1-yl]hept-5-enoate |
| InChIKey | HVBMOWIJGLUCFB-PMPHTVEESA-N |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCC(=O)OC)O |
Computed by PubChem (NCBI)