Products 318238-05-0

CAS 318238-05-0 is the registry number for Methyl 1,5-bis(4-chlorophenyl)-1H-pyrazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.

Structural formula: {0} (CAS {1})

Methyl 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylate (CAS 318238-05-0) is a chemical compound with the molecular formula C17H12Cl2N2O2 and a molecular weight of 347.2 g/mol. IUPAC name: methyl 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylate. InChIKey: QCBFRCIISUTMBF-UHFFFAOYSA-N.

Identity
Molecular formulaC17H12Cl2N2O2
Molecular weight347.2 g/mol
IUPAC namemethyl 1,5-bis(4-chlorophenyl)pyrazole-3-carboxylate
InChIKeyQCBFRCIISUTMBF-UHFFFAOYSA-N
SMILESCOC(=O)C1=NN(C(=C1)C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl

Computed by PubChem (NCBI)