Products 318256-21-2

CAS 318256-21-2 is the registry number for Methyl 5-(3,4-dichlorophenyl)-1-phenyl-1H-pyrazole-3-carboxylate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

Methyl 5-(3,4-dichlorophenyl)-1-phenylpyrazole-3-carboxylate (CAS 318256-21-2) is a chemical compound with the molecular formula C17H12Cl2N2O2 and a molecular weight of 347.2 g/mol. IUPAC name: methyl 5-(3,4-dichlorophenyl)-1-phenylpyrazole-3-carboxylate. InChIKey: QSAFFKZVADBCJK-UHFFFAOYSA-N.

Identity
Molecular formulaC17H12Cl2N2O2
Molecular weight347.2 g/mol
IUPAC namemethyl 5-(3,4-dichlorophenyl)-1-phenylpyrazole-3-carboxylate
InChIKeyQSAFFKZVADBCJK-UHFFFAOYSA-N
SMILESCOC(=O)C1=NN(C(=C1)C2=CC(=C(C=C2)Cl)Cl)C3=CC=CC=C3

Computed by PubChem (NCBI)