CAS 318463-07-9 is the registry number for 4,7-dichlorobenzo(b)thiophene. Offered by: Chemat Brand. Available pack sizes: on request.
4,7-dichloro-1-benzothiophene (CAS 318463-07-9) is a chemical compound with the molecular formula C8H4Cl2S and a molecular weight of 203.09 g/mol. IUPAC name: 4,7-dichloro-1-benzothiophene. InChIKey: JNIOIHBMZGPVRZ-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2S |
|---|---|
| Molecular weight | 203.09 g/mol |
| IUPAC name | 4,7-dichloro-1-benzothiophene |
| InChIKey | JNIOIHBMZGPVRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)C=CS2)Cl |
Computed by PubChem (NCBI)