CAS 5323-97-7 appears in our catalog under these names: 2,3-Dichloro-1-benzothiophene, 95%, 2,3-Dichloro-1-benzothiophene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2,3-dichloro-1-benzothiophene (CAS 5323-97-7) is a chemical compound with the molecular formula C8H4Cl2S and a molecular weight of 203.09 g/mol. IUPAC name: 2,3-dichloro-1-benzothiophene. InChIKey: ACKJNFZJNNOLCP-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2S |
|---|---|
| Molecular weight | 203.09 g/mol |
| IUPAC name | 2,3-dichloro-1-benzothiophene |
| InChIKey | ACKJNFZJNNOLCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(S2)Cl)Cl |
Computed by PubChem (NCBI)