CAS 318511-70-5 is the registry number for tert-Butyl 2-acetyl-4-oxopentanoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Tert-butyl 2-acetyl-4-oxopentanoate (CAS 318511-70-5) is a chemical compound with the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. IUPAC name: tert-butyl 2-acetyl-4-oxopentanoate. InChIKey: CHAMKNSLGLXNAG-UHFFFAOYSA-N.
| Molecular formula | C11H18O4 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | tert-butyl 2-acetyl-4-oxopentanoate |
| InChIKey | CHAMKNSLGLXNAG-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C(=O)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)