CAS 31867-92-2 appears in our catalog under these names: 4-Chloro-6,7-dimethylquinazoline, 98+%, 4-Chloro-6,7-dimethylquinazoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-chloro-6,7-dimethylquinazoline (CAS 31867-92-2) is a chemical compound with the molecular formula C10H9ClN2 and a molecular weight of 192.64 g/mol. IUPAC name: 4-chloro-6,7-dimethylquinazoline. InChIKey: WIKQNBCDJYNKED-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | 4-chloro-6,7-dimethylquinazoline |
| InChIKey | WIKQNBCDJYNKED-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N=CN=C2Cl |
Computed by PubChem (NCBI)