CAS 3189-48-8 appears in our catalog under these names: Indolizine-2-carboxylic acid, 95%, Indolizine-2-carboxylic Acid, Indolizine-2-carboxylic acid, 97%, Indolizine-2-carboxylic acid 95%, Indolizine-2-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 100mg, 5g, 500mg, 2.5g, 25g.
Indolizine-2-carboxylic acid (CAS 3189-48-8) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: indolizine-2-carboxylic acid. InChIKey: QSJHENXHFPTGKD-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | indolizine-2-carboxylic acid |
| InChIKey | QSJHENXHFPTGKD-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN2C=C1)C(=O)O |
Computed by PubChem (NCBI)