CAS 319490-90-9 is the registry number for 7-Ethoxy-2-oxo-1,2-dihydroquinoline-3-carbaldehyde. Offered by: Biosynth. Available pack sizes: 50mg.
7-ethoxy-2-oxo-1H-quinoline-3-carbaldehyde (CAS 319490-90-9) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 7-ethoxy-2-oxo-1H-quinoline-3-carbaldehyde. InChIKey: CYTKPGMPOSVASD-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 7-ethoxy-2-oxo-1H-quinoline-3-carbaldehyde |
| InChIKey | CYTKPGMPOSVASD-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)C=C(C(=O)N2)C=O |
Computed by PubChem (NCBI)