Products 31964-52-0
CAS 31964-52-0 is the registry number for 3,4-Dihydroisoquinoline-2(1h)-carbothioamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3,4-dihydro-1H-isoquinoline-2-carbothioamide (CAS 31964-52-0) is a chemical compound with the molecular formula C10H12N2S and a molecular weight of 192.28 g/mol. IUPAC name: 3,4-dihydro-1H-isoquinoline-2-carbothioamide. InChIKey: JZQZVILRSLXZCO-UHFFFAOYSA-N.
| Molecular formula | C10H12N2S |
|---|---|
| Molecular weight | 192.28 g/mol |
| IUPAC name | 3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| InChIKey | JZQZVILRSLXZCO-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C(=S)N |
Computed by PubChem (NCBI)