CAS 320-30-9 is the registry number for 4-Chloro-1,2-bis-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-chloro-1,2-bis(trifluoromethyl)benzene (CAS 320-30-9) is a chemical compound with the molecular formula C8H3ClF6 and a molecular weight of 248.55 g/mol. IUPAC name: 4-chloro-1,2-bis(trifluoromethyl)benzene. InChIKey: PWDDGDIIBURINF-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF6 |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | 4-chloro-1,2-bis(trifluoromethyl)benzene |
| InChIKey | PWDDGDIIBURINF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)