CAS 328-72-3 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)chlorobenzene 97%, 3,5-Bis(trifluoromethyl)chlorobenzene, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
1-chloro-3,5-bis(trifluoromethyl)benzene (CAS 328-72-3) is a chemical compound with the molecular formula C8H3ClF6 and a molecular weight of 248.55 g/mol. IUPAC name: 1-chloro-3,5-bis(trifluoromethyl)benzene. InChIKey: OXMBWPJFVUPOFO-UHFFFAOYSA-N.
| Molecular formula | C8H3ClF6 |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | 1-chloro-3,5-bis(trifluoromethyl)benzene |
| InChIKey | OXMBWPJFVUPOFO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)