CAS 320420-77-7 appears in our catalog under these names: 5-Methyl-1-(3-(trifluoromethyl)benzyl)indoline-2,3-dione, 98%, 98%, 5-Methyl-1-(3-(trifluoromethyl)benzyl)indoline-2,3-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 10mg, 500mg, 5g.
5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2,3-dione (CAS 320420-77-7) is a chemical compound with the molecular formula C17H12F3NO2 and a molecular weight of 319.28 g/mol. IUPAC name: 5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2,3-dione. InChIKey: MAHDJSVPOKRTDT-UHFFFAOYSA-N.
| Molecular formula | C17H12F3NO2 |
|---|---|
| Molecular weight | 319.28 g/mol |
| IUPAC name | 5-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2,3-dione |
| InChIKey | MAHDJSVPOKRTDT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=O)C2=O)CC3=CC(=CC=C3)C(F)(F)F |
Computed by PubChem (NCBI)