CAS 320421-51-0 appears in our catalog under these names: 4-Amino-2-cyano-3'-(trifluoromethyl)diphenyl thioether, 95%, 5-Amino-2-{(3-(trifluoromethyl)phenyl)sulfanyl} benzenecarbonitrile, 95+%, 5-Amino-2-{[3-(trifluoromethyl)phenyl]sulfanyl}benzonitrile. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
5-amino-2-[3-(trifluoromethyl)phenyl]sulfanylbenzonitrile (CAS 320421-51-0) is a chemical compound with the molecular formula C14H9F3N2S and a molecular weight of 294.30 g/mol. IUPAC name: 5-amino-2-[3-(trifluoromethyl)phenyl]sulfanylbenzonitrile. InChIKey: UIXJHGHFWHSBEZ-UHFFFAOYSA-N.
| Molecular formula | C14H9F3N2S |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | 5-amino-2-[3-(trifluoromethyl)phenyl]sulfanylbenzonitrile |
| InChIKey | UIXJHGHFWHSBEZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)SC2=C(C=C(C=C2)N)C#N)C(F)(F)F |
Computed by PubChem (NCBI)