CAS 400751-63-5 is the registry number for 3-Amino-4-{(3-(trifluoromethyl)phenyl)sulfanyl} benzenecarbonitrile, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
3-amino-4-[3-(trifluoromethyl)phenyl]sulfanylbenzonitrile (CAS 400751-63-5) is a chemical compound with the molecular formula C14H9F3N2S and a molecular weight of 294.30 g/mol. IUPAC name: 3-amino-4-[3-(trifluoromethyl)phenyl]sulfanylbenzonitrile. InChIKey: OOBUSBNDDQZYRZ-UHFFFAOYSA-N.
| Molecular formula | C14H9F3N2S |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | 3-amino-4-[3-(trifluoromethyl)phenyl]sulfanylbenzonitrile |
| InChIKey | OOBUSBNDDQZYRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)SC2=C(C=C(C=C2)C#N)N)C(F)(F)F |
Computed by PubChem (NCBI)