CAS 3205-34-3 appears in our catalog under these names: (1S,2S)-1,2-Cyclohexanedimethanol, >95% (GC), (1S,2S,(-))-1,2-Cyclohexanedimethanol, (1S,2S)-Cyclohexane-1,2-diyldimethanol 97%, (1S,2S)-1,2-Cyclohexanedimethanol, 97%, 97%, (1S,2S)-Cyclohexane-1,2-diyldimethanol, 98%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 25g, 5g, 250mg, 10g, 15g.
[(1S,2S)-2-(hydroxymethyl)cyclohexyl]methanol (CAS 3205-34-3) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. IUPAC name: [(1S,2S)-2-(hydroxymethyl)cyclohexyl]methanol. InChIKey: XDODWINGEHBYRT-HTQZYQBOSA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 144.21 g/mol |
| IUPAC name | [(1S,2S)-2-(hydroxymethyl)cyclohexyl]methanol |
| InChIKey | XDODWINGEHBYRT-HTQZYQBOSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)CO)CO |
Computed by PubChem (NCBI)