CAS 65376-05-8 appears in our catalog under these names: (R)-trans-1,2-Bis-hydroxymethyl-cyclohexan, (1R,2R)-1,2-Cyclohexanedimethanol, (1R,2R)-Cyclohexane-1,2-diyldimethanol, 97%, (1R,2R)–1,2–Cyclohexanedimethanol, (1R,2R)-1,2-Cyclohexanedimethanol, >98.0%(GC). Offered by: Chemat Brand, TRC, AmBeed, GLPBio, TCI. Available pack sizes: on request, 25mg, 5g, 25g, 10g, 1g, 100g, 500g.
[(1R,2R)-2-(hydroxymethyl)cyclohexyl]methanol (CAS 65376-05-8) is a chemical compound with the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. IUPAC name: [(1R,2R)-2-(hydroxymethyl)cyclohexyl]methanol. InChIKey: XDODWINGEHBYRT-YUMQZZPRSA-N.
| Molecular formula | C8H16O2 |
|---|---|
| Molecular weight | 144.21 g/mol |
| IUPAC name | [(1R,2R)-2-(hydroxymethyl)cyclohexyl]methanol |
| InChIKey | XDODWINGEHBYRT-YUMQZZPRSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)CO)CO |
Computed by PubChem (NCBI)