CAS 320734-43-8 appears in our catalog under these names: 1,5-Bis(4-methyl-naphthalene-1-yl)-pentane-1,5-dione, 95%, 1,5-Bis(4-Methyl-naphthalene-1-yl)-pentane-1,5-dione. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
1,5-bis(4-methylnaphthalen-1-yl)pentane-1,5-dione (CAS 320734-43-8) is a chemical compound with the molecular formula C27H24O2 and a molecular weight of 380.5 g/mol. IUPAC name: 1,5-bis(4-methylnaphthalen-1-yl)pentane-1,5-dione. InChIKey: JFKIMJUVVRSLCP-UHFFFAOYSA-N.
| Molecular formula | C27H24O2 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | 1,5-bis(4-methylnaphthalen-1-yl)pentane-1,5-dione |
| InChIKey | JFKIMJUVVRSLCP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C2=CC=CC=C12)C(=O)CCCC(=O)C3=CC=C(C4=CC=CC=C43)C |
Computed by PubChem (NCBI)