CAS 32081-22-4 appears in our catalog under these names: Poly(2,5-dioctyl-1,4-phenylenevinylene), Quinolino[3,2,1-de]acridine-5,9-dione, 98%, 98%, DiKTa, 98%. Offered by: Lumtec, Chemat, Ambeed. Available pack sizes: On request, 100mg, 250mg, 1g.
1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaene-8,14-dione (CAS 32081-22-4) is a chemical compound with the molecular formula C20H11NO2 and a molecular weight of 297.3 g/mol. IUPAC name: 1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaene-8,14-dione. InChIKey: YDGSSOWNWNPOKN-UHFFFAOYSA-N.
| Molecular formula | C20H11NO2 |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaene-8,14-dione |
| InChIKey | YDGSSOWNWNPOKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C4N2C5=CC=CC=C5C(=O)C4=CC=C3 |
Computed by PubChem (NCBI)