CAS 42189-56-0 appears in our catalog under these names: N-(1-Pyrenyl) Maleimide, >95% (HPLC), 1–(Pyren–1–yl)–1H–pyrrole–2,5–dione, N-(1-Pyrenyl)maleimide, >97.0%(HPLC), N-(1-Pyrenyl)maleimide 98%, 1-(Pyren-1-yl)-1H-pyrrole-2,5-dione, 99%, 99%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 100mg, 50mg, 10g, 1g, 250mg, 5g, 1 g, 500 mg.
1-pyren-1-ylpyrrole-2,5-dione (CAS 42189-56-0) is a chemical compound with the molecular formula C20H11NO2 and a molecular weight of 297.3 g/mol. IUPAC name: 1-pyren-1-ylpyrrole-2,5-dione. InChIKey: YXKWRQLPBHVBRP-UHFFFAOYSA-N.
| Molecular formula | C20H11NO2 |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 1-pyren-1-ylpyrrole-2,5-dione |
| InChIKey | YXKWRQLPBHVBRP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)N5C(=O)C=CC5=O |
Computed by PubChem (NCBI)