CAS 32114-57-1 is the registry number for 2-Nitrobenzene-1,3-diamine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-nitrobenzene-1,3-diamine (CAS 32114-57-1) is a chemical compound with the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. IUPAC name: 2-nitrobenzene-1,3-diamine. InChIKey: YYVUIHJUCYWJCG-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O2 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 2-nitrobenzene-1,3-diamine |
| InChIKey | YYVUIHJUCYWJCG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)N)[N+](=O)[O-])N |
Computed by PubChem (NCBI)