CAS 321345-36-2 appears in our catalog under these names: [1-(3-Fluorophenyl)-1-tosyl]methyl isocyanide, 95%, (1-(3-Fluorophenyl)-1-tosyl)methyl Isocyanide, 1-Fluoro-3-(isocyano(tosyl)methyl)benzene, 95+%, 1-Fluoro-3-(isocyano(tosyl)methyl)benzene 98%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 5g, 1g, 100mg, 500mg, 50mg, 250mg.
1-fluoro-3-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene (CAS 321345-36-2) is a chemical compound with the molecular formula C15H12FNO2S and a molecular weight of 289.3 g/mol. IUPAC name: 1-fluoro-3-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene. InChIKey: QOEGZIMRMSXLIL-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO2S |
|---|---|
| Molecular weight | 289.3 g/mol |
| IUPAC name | 1-fluoro-3-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene |
| InChIKey | QOEGZIMRMSXLIL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC(=CC=C2)F)[N+]#[C-] |
Computed by PubChem (NCBI)