CAS 660431-65-2 appears in our catalog under these names: [1-(2-Fluorophenyl)-1-tosyl]methyl isocyanide, 95%, [1-(2-Fluorophenyl)-1-tosyl]methyl isocyanide, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
1-fluoro-2-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene (CAS 660431-65-2) is a chemical compound with the molecular formula C15H12FNO2S and a molecular weight of 289.3 g/mol. IUPAC name: 1-fluoro-2-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene. InChIKey: LQZNUAYEVVHGQW-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO2S |
|---|---|
| Molecular weight | 289.3 g/mol |
| IUPAC name | 1-fluoro-2-[isocyano-(4-methylphenyl)sulfonylmethyl]benzene |
| InChIKey | LQZNUAYEVVHGQW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC=CC=C2F)[N+]#[C-] |
Computed by PubChem (NCBI)