CAS 32166-02-2 appears in our catalog under these names: CIS-2,6-DIMETHYLPIPERIDINE HYDROCHLORIDE, 98%, 98%, cis-2,6-Dimethylpiperidine (hydrochloride), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2R,6S)-2,6-dimethylpiperidine;hydrochloride (CAS 32166-02-2) is a chemical compound with the molecular formula C7H16ClN and a molecular weight of 149.66 g/mol. IUPAC name: (2R,6S)-2,6-dimethylpiperidine;hydrochloride. InChIKey: PEDXCVQZZVVOGO-UKMDXRBESA-N.
| Molecular formula | C7H16ClN |
|---|---|
| Molecular weight | 149.66 g/mol |
| IUPAC name | (2R,6S)-2,6-dimethylpiperidine;hydrochloride |
| InChIKey | PEDXCVQZZVVOGO-UKMDXRBESA-N |
| SMILES | C[C@@H]1CCC[C@@H](N1)C.Cl |
Computed by PubChem (NCBI)