CAS 321705-40-2 is the registry number for N-(4-Fluorobenzyl) 2-bromobenzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-N-[(4-fluorophenyl)methyl]benzenesulfonamide (CAS 321705-40-2) is a chemical compound with the molecular formula C13H11BrFNO2S and a molecular weight of 344.20 g/mol. IUPAC name: 2-bromo-N-[(4-fluorophenyl)methyl]benzenesulfonamide. InChIKey: KTEXFVTXZKHHSY-UHFFFAOYSA-N.
| Molecular formula | C13H11BrFNO2S |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | 2-bromo-N-[(4-fluorophenyl)methyl]benzenesulfonamide |
| InChIKey | KTEXFVTXZKHHSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)S(=O)(=O)NCC2=CC=C(C=C2)F)Br |
Computed by PubChem (NCBI)