CAS 439934-35-7 appears in our catalog under these names: 4-Bromo-n-(3-fluoro-4-methylphenyl)benzenesulfonamide, 95%, 4–bromo–N–(3–fluoro–4–methylphenyl)–benzenesulfonamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g.
4-bromo-N-(3-fluoro-4-methylphenyl)benzenesulfonamide (CAS 439934-35-7) is a chemical compound with the molecular formula C13H11BrFNO2S and a molecular weight of 344.20 g/mol. IUPAC name: 4-bromo-N-(3-fluoro-4-methylphenyl)benzenesulfonamide. InChIKey: WRVXCZVAZKXKTO-UHFFFAOYSA-N.
| Molecular formula | C13H11BrFNO2S |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | 4-bromo-N-(3-fluoro-4-methylphenyl)benzenesulfonamide |
| InChIKey | WRVXCZVAZKXKTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)Br)F |
Computed by PubChem (NCBI)