CAS 321706-24-5 is the registry number for (2-(3,4-dimethoxyphenyl)ethyl)((4-nitrophenyl)sulfonyl)amine. Offered by: Biosynth. Available pack sizes: 250mg.
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-nitrobenzenesulfonamide (CAS 321706-24-5) is a chemical compound with the molecular formula C16H18N2O6S and a molecular weight of 366.4 g/mol. IUPAC name: N-[2-(3,4-dimethoxyphenyl)ethyl]-4-nitrobenzenesulfonamide. InChIKey: OFZQFKSYLRCFCJ-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O6S |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-nitrobenzenesulfonamide |
| InChIKey | OFZQFKSYLRCFCJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CCNS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)