CAS 322474-09-9 appears in our catalog under these names: 2-Methoxy-5-(2-nitroethyl)phenol, 95%, 2–methoxy–5–(2–nitroethyl)phenol, 1-(3-Hydroxy-4-methoxyphenyl)-2-nitroethane. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 200mg.
2-methoxy-5-(2-nitroethyl)phenol (CAS 322474-09-9) is a chemical compound with the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. IUPAC name: 2-methoxy-5-(2-nitroethyl)phenol. InChIKey: ITIMUCQQHDXMIW-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4 |
|---|---|
| Molecular weight | 197.19 g/mol |
| IUPAC name | 2-methoxy-5-(2-nitroethyl)phenol |
| InChIKey | ITIMUCQQHDXMIW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC[N+](=O)[O-])O |
Computed by PubChem (NCBI)