Products 322639-07-6
CAS 322639-07-6 is the registry number for (S)-Dinotefuran. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methyl-1-nitro-3-[[(3S)-oxolan-3-yl]methyl]guanidine (CAS 322639-07-6) is a chemical compound with the molecular formula C7H14N4O3 and a molecular weight of 202.21 g/mol. IUPAC name: 2-methyl-1-nitro-3-[[(3S)-oxolan-3-yl]methyl]guanidine. InChIKey: YKBZOVFACRVRJN-LURJTMIESA-N.
| Molecular formula | C7H14N4O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 2-methyl-1-nitro-3-[[(3S)-oxolan-3-yl]methyl]guanidine |
| InChIKey | YKBZOVFACRVRJN-LURJTMIESA-N |
| SMILES | CN=C(NC[C@@H]1CCOC1)N[N+](=O)[O-] |
Computed by PubChem (NCBI)