CAS 93964-76-2 is the registry number for Formyl-L-arginine. Offered by: TRC. Available pack sizes: 50mg.
(2S)-5-(diaminomethylideneamino)-2-formamidopentanoic acid (CAS 93964-76-2) is a chemical compound with the molecular formula C7H14N4O3 and a molecular weight of 202.21 g/mol. IUPAC name: (2S)-5-(diaminomethylideneamino)-2-formamidopentanoic acid. InChIKey: MBDCBOQSTZRKJP-YFKPBYRVSA-N.
| Molecular formula | C7H14N4O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | (2S)-5-(diaminomethylideneamino)-2-formamidopentanoic acid |
| InChIKey | MBDCBOQSTZRKJP-YFKPBYRVSA-N |
| SMILES | C(C[C@@H](C(=O)O)NC=O)CN=C(N)N |
Computed by PubChem (NCBI)