CAS 32272-98-3 is the registry number for 5-Bromo-7-chloro-2,3-dihydro-1,3-benzoxazol-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-7-chloro-3H-1,3-benzoxazol-2-one (CAS 32272-98-3) is a chemical compound with the molecular formula C7H3BrClNO2 and a molecular weight of 248.46 g/mol. IUPAC name: 5-bromo-7-chloro-3H-1,3-benzoxazol-2-one. InChIKey: PXVJXLQVOGNYMR-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO2 |
|---|---|
| Molecular weight | 248.46 g/mol |
| IUPAC name | 5-bromo-7-chloro-3H-1,3-benzoxazol-2-one |
| InChIKey | PXVJXLQVOGNYMR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)O2)Cl)Br |
Computed by PubChem (NCBI)