CAS 855996-74-6 is the registry number for 6-Bromo-5-chloro-1,2-benzoxazol-3-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-bromo-5-chloro-1,2-benzoxazol-3-one (CAS 855996-74-6) is a chemical compound with the molecular formula C7H3BrClNO2 and a molecular weight of 248.46 g/mol. IUPAC name: 6-bromo-5-chloro-1,2-benzoxazol-3-one. InChIKey: BSLISWPSAUKPKC-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClNO2 |
|---|---|
| Molecular weight | 248.46 g/mol |
| IUPAC name | 6-bromo-5-chloro-1,2-benzoxazol-3-one |
| InChIKey | BSLISWPSAUKPKC-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Br)ONC2=O |
Computed by PubChem (NCBI)