CAS 32274-51-4 is the registry number for Arenol. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 25mg, 10mg, 50mg.
3-[[4-acetyl-2,3,6-trihydroxy-5-(3-methylbut-2-enyl)phenyl]methyl]-4-hydroxy-5,6-dimethylpyran-2-one (CAS 32274-51-4) is a chemical compound with the molecular formula C21H24O7 and a molecular weight of 388.4 g/mol. IUPAC name: 3-[[4-acetyl-2,3,6-trihydroxy-5-(3-methylbut-2-enyl)phenyl]methyl]-4-hydroxy-5,6-dimethylpyran-2-one. InChIKey: BGLAMXJBTZOWLK-UHFFFAOYSA-N.
| Molecular formula | C21H24O7 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 3-[[4-acetyl-2,3,6-trihydroxy-5-(3-methylbut-2-enyl)phenyl]methyl]-4-hydroxy-5,6-dimethylpyran-2-one |
| InChIKey | BGLAMXJBTZOWLK-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=O)C(=C1O)CC2=C(C(=C(C(=C2O)O)C(=O)C)CC=C(C)C)O)C |
Computed by PubChem (NCBI)