CAS 4992-73-8 is the registry number for Rac Dihydro Samidin. Offered by: TRC. Available pack sizes: 10mg.
[(9S,10S)-10-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] 3-methylbutanoate (CAS 4992-73-8) is a chemical compound with the molecular formula C21H24O7 and a molecular weight of 388.4 g/mol. IUPAC name: [(9S,10S)-10-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] 3-methylbutanoate. InChIKey: ALKTVPFKDYZFGA-PMACEKPBSA-N.
| Molecular formula | C21H24O7 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | [(9S,10S)-10-acetyloxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-9-yl] 3-methylbutanoate |
| InChIKey | ALKTVPFKDYZFGA-PMACEKPBSA-N |
| SMILES | CC(C)CC(=O)O[C@H]1[C@H](C2=C(C=CC3=C2OC(=O)C=C3)OC1(C)C)OC(=O)C |
Computed by PubChem (NCBI)